What is the formula of phenyl acetate?
C8H8O2Phenyl acetate / Formula
What is the formula of phenyl acetic acid?
C8H8O2Phenylacetic acid / Formula
What is the Iupac name of phenylacetic acid?
| IUPAC Name | 2-phenylacetic acid |
|---|---|
| Alternative Names | PHENYLACETIC ACID Benzeneacetic acid 2-Phenylacetic acid alpha-Toluic acid Phenylethanoic acid |
| Molecular Formula | C8H8O2 |
| Molar Mass | 136.15 g/mol |
| InChI | InChI=1S/C8H8O2/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,10) |
What is the structure of 2 Phenylethanoic acid?
2-Phenylethanoic acid chloride
| PubChem CID | 53433161 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C8H8ClO2- |
| Synonyms | 2-phenylacetic acid chloride 2-phenylethanoic acid chloride A817612 |
| Molecular Weight | 171.60 |
What is the conjugate base of phenylacetic acid?
Phenylacetate
Phenylacetate is a monocarboxylic acid anion that is the conjugate base of phenylacetic acid. It has a role as a human metabolite, an Escherichia coli metabolite, a plant metabolite and a Saccharomyces cerevisiae metabolite.
What is the structure of phenyl acetaldehyde?
C8H8OPhenylacetaldehyde / Formula
What is PhCOOH?
+ PhCOOH,,, (1) in which PhCOOH is the reference acid (benzoic acid).
What is the structure of O hydroxybenzoic acid?
o-Hydroxybenzoic acid 3-(2,3-dimethylpiperidino)propyl ester hydrochloride | C17H26ClNO3 – PubChem.
Is phenylacetic acid An aromatic carboxylic acid?
Solution. Yes, phenyl acetic acid is a side-chain aromatic carboxylic acid.
What is phenyl aldehyde?
Phenylacetaldehyde is an aldehyde that consists of acetaldehyde bearing a phenyl substituent; the parent member of the phenylacetaldehyde class of compounds. It has a role as a human metabolite, a Saccharomyces cerevisiae metabolite, an Escherichia coli metabolite and a mouse metabolite.
What is the name of the compound with the formula phenylacetic acid?
Phenylacetic acid is a monocarboxylic acid that is toluenein which one of the hydrogens of the methylgroup has been replaced by a carboxy group.
What is the formula for acetic anhydride?
Acetic anhydride is an acyclic carboxylic anhydride derived from acetic acid. It has a role as a metabolite and a reagent. acetyl acetate Computed by Lexichem TK 2.7.0 (PubChem release 2021.05.07) InChI=1S/C4H6O3/c1-3 (5)7-4 (2)6/h1-2H3 Computed by InChI 1.0.6 (PubChem release 2021.05.07) WFDIJRYMOXRFFG-UHFFFAOYSA-N
What is the mechanism of action of phenylacetic acid?
Phenylacetic acid is a Nitrogen Binding Agent. The mechanism of action of phenylacetic acid is as an Ammonium Ion Binding Activity.
What is the concentration of phenylacetic acid at 25 °C?
76-78 °C (lit.) 1.081 g/mL at 25 °C (lit.) Looking for similar products? Visit Product Comparison Guide Phenylacetic acid can be used to synthesize a variety of phenyl substituted compounds by Pd (II)-catalyzed C-H activation/aryl-aryl coupling reaction.